CAS 185961-44-8 appears in our catalog under these names: 8-Acetoxy-3-methylquinoline, 3-Methylquinolin-8-yl acetate 97%, 3-Methylquinolin-8-yl acetate, 97%, 97%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 500mg, 50mg, 100mg, 250mg, 1g.
(3-methylquinolin-8-yl) acetate (CAS 185961-44-8) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: (3-methylquinolin-8-yl) acetate. InChIKey: UFEDBSXWGPWPLE-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (3-methylquinolin-8-yl) acetate |
| InChIKey | UFEDBSXWGPWPLE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CC=C2)OC(=O)C)N=C1 |
Computed by PubChem (NCBI)