CAS 186267-76-5 appears in our catalog under these names: 6-Bromo-5-methyl-1,4-dihydro-benzo[d][1,3]oxazin-2-one, 95%, 6-Bromo-5-methyl-1H-benzo(d)(1,3)oxazin-2(4H)-one, 95%, 6-Bromo-5-methyl-1,4-dihydro-benzo[d][1,3]oxazin-2-one, ≥95%, ≥95%, 6-Bromo-5-methyl-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
6-bromo-5-methyl-1,4-dihydro-3,1-benzoxazin-2-one (CAS 186267-76-5) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-5-methyl-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: VSNATEZGRNWSTQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-5-methyl-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | VSNATEZGRNWSTQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1COC(=O)N2)Br |
Computed by PubChem (NCBI)