CAS 203854-58-4 appears in our catalog under these names: (S)-3-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)-2-Methylpropanoic Acid, 95%, 95%, (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpropanoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid (CAS 203854-58-4) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid. InChIKey: BMUDOYSTGJHGNI-LBPRGKRZSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid |
| InChIKey | BMUDOYSTGJHGNI-LBPRGKRZSA-N |
| SMILES | C[C@@H](CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)