Products 1864760-31-5
CAS 1864760-31-5 is the registry number for 3-(4-Bromophenyl)prop-2-en-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(E)-3-(4-bromophenyl)prop-2-en-1-amine;hydrochloride (CAS 1864760-31-5) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: (E)-3-(4-bromophenyl)prop-2-en-1-amine;hydrochloride. InChIKey: UTROOURKHTUDDG-TYYBGVCCSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)prop-2-en-1-amine;hydrochloride |
| InChIKey | UTROOURKHTUDDG-TYYBGVCCSA-N |
| SMILES | C1=CC(=CC=C1/C=C/CN)Br.Cl |
Computed by PubChem (NCBI)