Products 2828433-48-1
CAS 2828433-48-1 appears in our catalog under these names: (E)-3-(4-Bromophenyl)prop-2-en-1-amine hydrochloride, 95%, 95%, (E)-3-(4-Bromophenyl)prop-2-en-1-amine hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-(4-bromophenyl)prop-2-en-1-amine;hydrochloride (CAS 2828433-48-1) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: (E)-3-(4-bromophenyl)prop-2-en-1-amine;hydrochloride. InChIKey: UTROOURKHTUDDG-TYYBGVCCSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)prop-2-en-1-amine;hydrochloride |
| InChIKey | UTROOURKHTUDDG-TYYBGVCCSA-N |
| SMILES | C1=CC(=CC=C1/C=C/CN)Br.Cl |
Computed by PubChem (NCBI)