CAS 186588-98-7 is the registry number for 2-Fluoro-A 85380 Tartrate Salt. Offered by: TRC. Available pack sizes: 100mg.
3-[[(2S)-azetidin-2-yl]methoxy]-2-fluoropyridine (CAS 186588-98-7) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 3-[[(2S)-azetidin-2-yl]methoxy]-2-fluoropyridine. InChIKey: GVOOYVOZPRROMP-ZETCQYMHSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 3-[[(2S)-azetidin-2-yl]methoxy]-2-fluoropyridine |
| InChIKey | GVOOYVOZPRROMP-ZETCQYMHSA-N |
| SMILES | C1CN[C@@H]1COC2=C(N=CC=C2)F |
Computed by PubChem (NCBI)