CAS 186593-26-0 appears in our catalog under these names: 5-Nitropyridin-3-ol, 5-Nitropyridin-3-ol 98%, 5-Nitro-3-pyridinol, 98%, 98%, 5-Nitropyridin-3-ol, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 500mg, 25g.
5-nitropyridin-3-ol (CAS 186593-26-0) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 5-nitropyridin-3-ol. InChIKey: GFNBWBJRTVNLMH-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 5-nitropyridin-3-ol |
| InChIKey | GFNBWBJRTVNLMH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1O)[N+](=O)[O-] |
Computed by PubChem (NCBI)