CAS 186971-85-7 is the registry number for 3,3'-(Naphthalene-2,6-diyl)diacrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[6-[(E)-2-carboxyethenyl]naphthalen-2-yl]prop-2-enoic acid (CAS 186971-85-7) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: (E)-3-[6-[(E)-2-carboxyethenyl]naphthalen-2-yl]prop-2-enoic acid. InChIKey: CGHWLODMCQXSJF-FCXRPNKRSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | (E)-3-[6-[(E)-2-carboxyethenyl]naphthalen-2-yl]prop-2-enoic acid |
| InChIKey | CGHWLODMCQXSJF-FCXRPNKRSA-N |
| SMILES | C1=CC2=C(C=C1/C=C/C(=O)O)C=CC(=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)