Products 187277-46-9
CAS 187277-46-9 is the registry number for rac-Irofulven. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,25mg, 0,1mg.
5'-hydroxy-1'-(hydroxymethyl)-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one (CAS 187277-46-9) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: 5'-hydroxy-1'-(hydroxymethyl)-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one. InChIKey: NICJCIQSJJKZAH-UHFFFAOYSA-N.
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 5'-hydroxy-1'-(hydroxymethyl)-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one |
| InChIKey | NICJCIQSJJKZAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C3(CC3)C(C(=O)C2=C1)(C)O)C)CO |
Computed by PubChem (NCBI)
Synonyms:
rac-Irofulven, (+/-)-Hydroxymethylacylfulvene