CAS 762243-29-8 appears in our catalog under these names: 5-(4-Isopropoxyphenyl)cyclohexane-1,3-dione, 95%, 5-(4-Isopropoxyphenyl)cyclohexane-1,3-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-(4-propan-2-yloxyphenyl)cyclohexane-1,3-dione (CAS 762243-29-8) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: 5-(4-propan-2-yloxyphenyl)cyclohexane-1,3-dione. InChIKey: KRSIOMKVWPQPSX-UHFFFAOYSA-N.
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 5-(4-propan-2-yloxyphenyl)cyclohexane-1,3-dione |
| InChIKey | KRSIOMKVWPQPSX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C2CC(=O)CC(=O)C2 |
Computed by PubChem (NCBI)