Products 107147-13-7

CAS 107147-13-7 is the registry number for 2-(4-Methylbenzoyl)cyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-methylbenzoyl)cyclohexane-1-carboxylic acid (CAS 107147-13-7) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: 2-(4-methylbenzoyl)cyclohexane-1-carboxylic acid. InChIKey: JHAROMYZTGWTSG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18O3
Molecular weight246.30 g/mol
IUPAC name2-(4-methylbenzoyl)cyclohexane-1-carboxylic acid
InChIKeyJHAROMYZTGWTSG-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C(=O)C2CCCCC2C(=O)O

Computed by PubChem (NCBI)