CAS 1350761-55-5 is the registry number for Methyl 2,2-dimethylspiro[chroman-4,1'-cyclopropane]-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,2-dimethylspiro[3H-chromene-4,1'-cyclopropane]-6-carboxylate (CAS 1350761-55-5) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: methyl 2,2-dimethylspiro[3H-chromene-4,1'-cyclopropane]-6-carboxylate. InChIKey: JDQSUDBYWMFXLI-UHFFFAOYSA-N.
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | methyl 2,2-dimethylspiro[3H-chromene-4,1'-cyclopropane]-6-carboxylate |
| InChIKey | JDQSUDBYWMFXLI-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CC2)C3=C(O1)C=CC(=C3)C(=O)OC)C |
Computed by PubChem (NCBI)