CAS 1177724-92-3 appears in our catalog under these names: 7-Hydroxy-4'-methylspiro[chromene-2,1'-cyclohexan]-4(3h)-one, 95%, 7–Hydroxy–4'–methylspiro(chromene–2,1'–cyclohexan)–4(3H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 500mg.
7-hydroxy-4'-methylspiro[3H-chromene-2,1'-cyclohexane]-4-one (CAS 1177724-92-3) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: 7-hydroxy-4'-methylspiro[3H-chromene-2,1'-cyclohexane]-4-one. InChIKey: DFXURMDUNBMQPF-UHFFFAOYSA-N.
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | 7-hydroxy-4'-methylspiro[3H-chromene-2,1'-cyclohexane]-4-one |
| InChIKey | DFXURMDUNBMQPF-UHFFFAOYSA-N |
| SMILES | CC1CCC2(CC1)CC(=O)C3=C(O2)C=C(C=C3)O |
Computed by PubChem (NCBI)