Products 1872972-95-6
CAS 1872972-95-6 is the registry number for 4-(3,5-Dichlorophenyl)-3,3-dimethylazetidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3,5-dichlorophenyl)-3,3-dimethylazetidin-2-one (CAS 1872972-95-6) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: 4-(3,5-dichlorophenyl)-3,3-dimethylazetidin-2-one. InChIKey: GEFZLRBWMKKLTM-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 4-(3,5-dichlorophenyl)-3,3-dimethylazetidin-2-one |
| InChIKey | GEFZLRBWMKKLTM-UHFFFAOYSA-N |
| SMILES | CC1(C(NC1=O)C2=CC(=CC(=C2)Cl)Cl)C |
Computed by PubChem (NCBI)