Products 187343-15-3
CAS 187343-15-3 is the registry number for 1,3:4,6-Di-O-benzylidene-2,5-dideoxy-2,5-imino-L-iditol. Offered by: Biosynth. Available pack sizes: 5mg.
(1R,2R,7S,9S)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane (CAS 187343-15-3) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: (1R,2R,7S,9S)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane. InChIKey: TZZNORDFNLLOEI-KCNXKABGSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (1R,2R,7S,9S)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
| InChIKey | TZZNORDFNLLOEI-KCNXKABGSA-N |
| SMILES | C1[C@H]2[C@H]([C@H]3[C@@H](N2)COC(O3)C4=CC=CC=C4)OC(O1)C5=CC=CC=C5 |
Computed by PubChem (NCBI)