CAS 221124-57-8 appears in our catalog under these names: Fmoc-meabu(4)-OH, 98%, 4–((((9H–Fluoren–9–yl)methoxy)carbonyl)(methyl)amino)butanoic acid, Fmoc-N-Me-Abu(4)-OH 98%, 4-[Fmoc-(methyl)amino]butanoic acid, 98%, 98%, 4-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)butanoic acid, 99.50%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 100mg, 50g, 25 g.
4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid (CAS 221124-57-8) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid. InChIKey: FBMGMJCITYNTQX-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid |
| InChIKey | FBMGMJCITYNTQX-UHFFFAOYSA-N |
| SMILES | CN(CCCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)