CAS 244031-65-0 appears in our catalog under these names: Fmoc-3-amino-3-methyl-butyric acid, 95%, Fmoc-3-amino-3-methyl-butyric acid, Fmoc-β-DL-Val-OH 97%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanoic acid, 97%, 97%, Fmoc-3-amino-3-methyl-butyric acid, 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 100mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid (CAS 244031-65-0) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid. InChIKey: PLCQKKONXZEZCF-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid |
| InChIKey | PLCQKKONXZEZCF-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)