Products 2655608-57-2
CAS 2655608-57-2 is the registry number for 1-Benzyl 3-methyl trans-4-phenylpyrrolidine-1,3-dicarboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-O-benzyl 3-O-methyl (3S,4R)-4-phenylpyrrolidine-1,3-dicarboxylate (CAS 2655608-57-2) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3S,4R)-4-phenylpyrrolidine-1,3-dicarboxylate. InChIKey: DRSLHYGLIMYAJO-ZWKOTPCHSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl (3S,4R)-4-phenylpyrrolidine-1,3-dicarboxylate |
| InChIKey | DRSLHYGLIMYAJO-ZWKOTPCHSA-N |
| SMILES | COC(=O)[C@@H]1CN(C[C@H]1C2=CC=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)