CAS 1874569-59-1 is the registry number for 3-(1H-Indol-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-indol-1-ylthiolane 1,1-dioxide (CAS 1874569-59-1) is a chemical compound with the molecular formula C12H13NO2S and a molecular weight of 235.30 g/mol. IUPAC name: 3-indol-1-ylthiolane 1,1-dioxide. InChIKey: WAUNZCOBRYHABC-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | 3-indol-1-ylthiolane 1,1-dioxide |
| InChIKey | WAUNZCOBRYHABC-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)