CAS 18761-31-4 appears in our catalog under these names: 5-Nitro-1-benzofuran, >95% (HPLC), 5-Nitrobenzofuran 96%, 5-Nitrobenzofuran, 98%, 98%, 5-Nitrobenzofuran, 99.91%, 5-Nitrobenzofuran (Standard). Offered by: TRC, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 25mg, 100 mg, 50 mg.
5-nitro-1-benzofuran (CAS 18761-31-4) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 5-nitro-1-benzofuran. InChIKey: LPMMCJSIUVQZFD-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5-nitro-1-benzofuran |
| InChIKey | LPMMCJSIUVQZFD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CO2)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)