CAS 18761-32-5 is the registry number for 7–Nitro–benzofuran. Offered by: GLPBio. Available pack sizes: 100mg.
7-nitro-1-benzofuran (CAS 18761-32-5) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 7-nitro-1-benzofuran. InChIKey: UWXIRVOEHNPCEV-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 7-nitro-1-benzofuran |
| InChIKey | UWXIRVOEHNPCEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])OC=C2 |
Computed by PubChem (NCBI)