Products 1877347-38-0
CAS 1877347-38-0 is the registry number for Darbinuradum. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[1-[[3-(4-cyanophenyl)-4-pyridinyl]sulfanylmethyl]cyclopropyl]acetic acid (CAS 1877347-38-0) is a chemical compound with the molecular formula C18H16N2O2S and a molecular weight of 324.4 g/mol. IUPAC name: 2-[1-[[3-(4-cyanophenyl)-4-pyridinyl]sulfanylmethyl]cyclopropyl]acetic acid. InChIKey: RHASGUGQMCVYMQ-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2-[1-[[3-(4-cyanophenyl)-4-pyridinyl]sulfanylmethyl]cyclopropyl]acetic acid |
| InChIKey | RHASGUGQMCVYMQ-UHFFFAOYSA-N |
| SMILES | C1CC1(CC(=O)O)CSC2=C(C=NC=C2)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)