CAS 187835-01-4 is the registry number for 4-(2,3-Dichlorophenyl)piperidine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3-dichlorophenyl)piperidine (CAS 187835-01-4) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)piperidine. InChIKey: YODQESWJUQGRPE-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)piperidine |
| InChIKey | YODQESWJUQGRPE-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)