CAS 187960-08-3 appears in our catalog under these names: Genistein-2’,3’,5’,6’-d4 (Major), >95% (HPLC), Genistein-d4 (4-hydroxyphenyl-2,3,5,6-d4), 95 atom % D, min 97% Chemical Purity, Genistein–d4, Genistein-d4, 98.81%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 5mg, 500μg, 1 mg.
5,7-dihydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)chromen-4-one (CAS 187960-08-3) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 274.26 g/mol. IUPAC name: 5,7-dihydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)chromen-4-one. InChIKey: TZBJGXHYKVUXJN-RHQRLBAQSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 274.26 g/mol |
| IUPAC name | 5,7-dihydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)chromen-4-one |
| InChIKey | TZBJGXHYKVUXJN-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=COC3=CC(=CC(=C3C2=O)O)O)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)