Products 315204-48-9
CAS 315204-48-9 is the registry number for Genistein-2’,6’-d2. Offered by: TRC. Available pack sizes: 0,5mg, 5mg.
3-(3,5-dideuterio-4-hydroxyphenyl)-5,7-dihydroxychromen-4-one (CAS 315204-48-9) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 272.25 g/mol. IUPAC name: 3-(3,5-dideuterio-4-hydroxyphenyl)-5,7-dihydroxychromen-4-one. InChIKey: TZBJGXHYKVUXJN-NMQOAUCRSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 3-(3,5-dideuterio-4-hydroxyphenyl)-5,7-dihydroxychromen-4-one |
| InChIKey | TZBJGXHYKVUXJN-NMQOAUCRSA-N |
| SMILES | [2H]C1=CC(=CC(=C1O)[2H])C2=COC3=CC(=CC(=C3C2=O)O)O |
Computed by PubChem (NCBI)