Products 187999-15-1
CAS 187999-15-1 is the registry number for 3-(4-Chlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid, 96%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid (CAS 187999-15-1) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: NRVQSRYGSQYPAG-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O3 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid |
| InChIKey | NRVQSRYGSQYPAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)