CAS 188-52-3 appears in our catalog under these names: [5]Helicene, >95.0%(HPLC), DIBENZO[C,G]PHENANTHRENE, 95.0%, 95.0%. Offered by: TCI, Chemat. Available pack sizes: 100mg.
Pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene (CAS 188-52-3) is a chemical compound with the molecular formula C22H14 and a molecular weight of 278.3 g/mol. IUPAC name: pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene. InChIKey: JKPCLJPYZMKPHM-UHFFFAOYSA-N.
| Molecular formula | C22H14 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene |
| InChIKey | JKPCLJPYZMKPHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(C=C3)C=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)