Products 1880830-14-7

CAS 1880830-14-7 is the registry number for Ethyl 2-(5,5-dimethyl-4-oxooxolan-3-yl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(5,5-dimethyl-4-oxooxolan-3-yl)-2-oxoacetate (CAS 1880830-14-7) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: ethyl 2-(5,5-dimethyl-4-oxooxolan-3-yl)-2-oxoacetate. InChIKey: AGNXAJRHVVXGPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O5
Molecular weight214.21 g/mol
IUPAC nameethyl 2-(5,5-dimethyl-4-oxooxolan-3-yl)-2-oxoacetate
InChIKeyAGNXAJRHVVXGPQ-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)C1COC(C1=O)(C)C

Computed by PubChem (NCBI)