CAS 1881295-39-1 is the registry number for benzyl N-(3-hydroxy-5-nitrophenyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl N-(3-hydroxy-5-nitrophenyl)carbamate (CAS 1881295-39-1) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: benzyl N-(3-hydroxy-5-nitrophenyl)carbamate. InChIKey: WGBJZQVMFGLCMX-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | benzyl N-(3-hydroxy-5-nitrophenyl)carbamate |
| InChIKey | WGBJZQVMFGLCMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=CC(=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)