CAS 2901864-94-4 is the registry number for 2-(2,6-Dioxopiperidin-3-yl)-4-(hydroxymethyl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dioxopiperidin-3-yl)-4-(hydroxymethyl)isoindole-1,3-dione (CAS 2901864-94-4) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-4-(hydroxymethyl)isoindole-1,3-dione. InChIKey: AUEAVFYOHITDGS-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-4-(hydroxymethyl)isoindole-1,3-dione |
| InChIKey | AUEAVFYOHITDGS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC(=C3C2=O)CO |
Computed by PubChem (NCBI)