CAS 73454-95-2 is the registry number for 2-Hydroxy-N-(4-methoxy-2-nitrophenyl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-N-(4-methoxy-2-nitrophenyl)benzamide (CAS 73454-95-2) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: 2-hydroxy-N-(4-methoxy-2-nitrophenyl)benzamide. InChIKey: YILLZUBIBYVGNB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 2-hydroxy-N-(4-methoxy-2-nitrophenyl)benzamide |
| InChIKey | YILLZUBIBYVGNB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC(=O)C2=CC=CC=C2O)[N+](=O)[O-] |
Computed by PubChem (NCBI)