Products 169604-46-0

CAS 169604-46-0 is the registry number for Phenyl N-(4-methoxy-2-nitrophenyl)carbamate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Phenyl N-(4-methoxy-2-nitrophenyl)carbamate (CAS 169604-46-0) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: phenyl N-(4-methoxy-2-nitrophenyl)carbamate. InChIKey: AVIQJJIORLWADD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12N2O5
Molecular weight288.25 g/mol
IUPAC namephenyl N-(4-methoxy-2-nitrophenyl)carbamate
InChIKeyAVIQJJIORLWADD-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)NC(=O)OC2=CC=CC=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)