CAS 169604-46-0 is the registry number for Phenyl N-(4-methoxy-2-nitrophenyl)carbamate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Phenyl N-(4-methoxy-2-nitrophenyl)carbamate (CAS 169604-46-0) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: phenyl N-(4-methoxy-2-nitrophenyl)carbamate. InChIKey: AVIQJJIORLWADD-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | phenyl N-(4-methoxy-2-nitrophenyl)carbamate |
| InChIKey | AVIQJJIORLWADD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC(=O)OC2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)