Products 2514685-03-9
CAS 2514685-03-9 is the registry number for 5-(5-Amino-2-hydroxybenzamido)-2-hydroxybenzoic Acid. Offered by: TRC. Available pack sizes: 2,5g.
5-[(5-amino-2-hydroxybenzoyl)amino]-2-hydroxybenzoic acid (CAS 2514685-03-9) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: 5-[(5-amino-2-hydroxybenzoyl)amino]-2-hydroxybenzoic acid. InChIKey: RZPZLDHCRUILJP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 5-[(5-amino-2-hydroxybenzoyl)amino]-2-hydroxybenzoic acid |
| InChIKey | RZPZLDHCRUILJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)NC2=CC(=C(C=C2)O)C(=O)O)O |
Computed by PubChem (NCBI)