CAS 145945-21-7 appears in our catalog under these names: CPS-11/ 99.55% (existing batch purity), CPS–11, CPS-11, CPS-11, 99.39%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 5 mg.
2-[1-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (CAS 145945-21-7) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: 2-[1-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione. InChIKey: LZHQPJSJEITGHB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 2-[1-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| InChIKey | LZHQPJSJEITGHB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C(=O)C1N2C(=O)C3=CC=CC=C3C2=O)CO |
Computed by PubChem (NCBI)