CAS 2714476-49-8 is the registry number for 5-Hydroxy-2-(3-methyl-2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydroxy-2-(3-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2714476-49-8) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: 5-hydroxy-2-(3-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: QTQBDRZCZDZWOR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 5-hydroxy-2-(3-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | QTQBDRZCZDZWOR-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=O)NC1=O)N2C(=O)C3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)