Products 1881329-34-5
CAS 1881329-34-5 is the registry number for 2-fluoro-6-methoxy-3-(trifluoromethyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-fluoro-6-methoxy-3-(trifluoromethyl)phenol (CAS 1881329-34-5) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: 2-fluoro-6-methoxy-3-(trifluoromethyl)phenol. InChIKey: HMLYTIRELRDCRR-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | 2-fluoro-6-methoxy-3-(trifluoromethyl)phenol |
| InChIKey | HMLYTIRELRDCRR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(F)(F)F)F)O |
Computed by PubChem (NCBI)