Products 1881290-53-4
CAS 1881290-53-4 is the registry number for 4-fluoro-3-(2,2,2-trifluoroethoxy)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-fluoro-3-(2,2,2-trifluoroethoxy)phenol (CAS 1881290-53-4) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: 4-fluoro-3-(2,2,2-trifluoroethoxy)phenol. InChIKey: NWGIJBBLTUZVKE-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | 4-fluoro-3-(2,2,2-trifluoroethoxy)phenol |
| InChIKey | NWGIJBBLTUZVKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)OCC(F)(F)F)F |
Computed by PubChem (NCBI)