Products 1026796-69-9
CAS 1026796-69-9 appears in our catalog under these names: 3-Fluoro-5-(2,2,2-trifluoroethoxy)phenol, 95%, 3-Fluoro-5-(2,2,2-trifluoroethoxy)phenol 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-fluoro-5-(2,2,2-trifluoroethoxy)phenol (CAS 1026796-69-9) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: 3-fluoro-5-(2,2,2-trifluoroethoxy)phenol. InChIKey: JSJFHYLGFURTCY-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | 3-fluoro-5-(2,2,2-trifluoroethoxy)phenol |
| InChIKey | JSJFHYLGFURTCY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OCC(F)(F)F)F)O |
Computed by PubChem (NCBI)