CAS 1092460-86-0 is the registry number for 5-Fluoro-2-(trifluoromethoxy)benzyl alcohol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[5-fluoro-2-(trifluoromethoxy)phenyl]methanol (CAS 1092460-86-0) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: [5-fluoro-2-(trifluoromethoxy)phenyl]methanol. InChIKey: JKXVLACUMFQMNS-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | [5-fluoro-2-(trifluoromethoxy)phenyl]methanol |
| InChIKey | JKXVLACUMFQMNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CO)OC(F)(F)F |
Computed by PubChem (NCBI)