CAS 362-56-1 is the registry number for 1,4-Dimethoxytetrafluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,2,4,5-tetrafluoro-3,6-dimethoxybenzene (CAS 362-56-1) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3,6-dimethoxybenzene. InChIKey: WQXKGOOORHDGFP-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3,6-dimethoxybenzene |
| InChIKey | WQXKGOOORHDGFP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1F)F)OC)F)F |
Computed by PubChem (NCBI)