CAS 35175-79-2 is the registry number for 4-Methoxy-2,3,5,6-tetrafluorobenzyl alcohol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanol (CAS 35175-79-2) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: (2,3,5,6-tetrafluoro-4-methoxyphenyl)methanol. InChIKey: GJEGXOUIWJIPTB-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | (2,3,5,6-tetrafluoro-4-methoxyphenyl)methanol |
| InChIKey | GJEGXOUIWJIPTB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1F)F)CO)F)F |
Computed by PubChem (NCBI)