CAS 188297-90-7 appears in our catalog under these names: Paraxanthine-1-methyl-d3, >95% (HPLC), 7-Methyl-1-(methyl-d3)-3,7-dihydro-1H-purine-2,6-dione. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
7-methyl-1-(trideuteriomethyl)-3H-purine-2,6-dione (CAS 188297-90-7) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 183.18 g/mol. IUPAC name: 7-methyl-1-(trideuteriomethyl)-3H-purine-2,6-dione. InChIKey: QUNWUDVFRNGTCO-BMSJAHLVSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 7-methyl-1-(trideuteriomethyl)-3H-purine-2,6-dione |
| InChIKey | QUNWUDVFRNGTCO-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C2=C(NC1=O)N=CN2C |
Computed by PubChem (NCBI)