CAS 65566-70-3 appears in our catalog under these names: Paraxanthine-d3, >95% (HPLC), Paraxanthine-d3. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
1-methyl-7-(trideuteriomethyl)-3H-purine-2,6-dione (CAS 65566-70-3) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 183.18 g/mol. IUPAC name: 1-methyl-7-(trideuteriomethyl)-3H-purine-2,6-dione. InChIKey: QUNWUDVFRNGTCO-FIBGUPNXSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 1-methyl-7-(trideuteriomethyl)-3H-purine-2,6-dione |
| InChIKey | QUNWUDVFRNGTCO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC2=C1C(=O)N(C(=O)N2)C |
Computed by PubChem (NCBI)