Products 1883190-87-1
CAS 1883190-87-1 appears in our catalog under these names: 2-Cyano-3-(1-methyl-1H-1,2,3-triazol-4-yl)acrylic acid, 95%, 95%, 2-Cyano-3-(1-methyl-1H-1,2,3-triazol-4-yl)acrylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-cyano-3-(1-methyltriazol-4-yl)prop-2-enoic acid (CAS 1883190-87-1) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 2-cyano-3-(1-methyltriazol-4-yl)prop-2-enoic acid. InChIKey: DYMARXZFFFIVGC-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 2-cyano-3-(1-methyltriazol-4-yl)prop-2-enoic acid |
| InChIKey | DYMARXZFFFIVGC-UHFFFAOYSA-N |
| SMILES | CN1C=C(N=N1)C=C(C#N)C(=O)O |
Computed by PubChem (NCBI)