CAS 1883347-30-5 appears in our catalog under these names: 3,5-Dichloro-6-ethylpyrazine-2-carboxylic acid, 96%, 3,5–Dichloro–6–ethylpyrazine–2–carboxylic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 250mg.
3,5-dichloro-6-ethylpyrazine-2-carboxylic acid (CAS 1883347-30-5) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: 3,5-dichloro-6-ethylpyrazine-2-carboxylic acid. InChIKey: KTDRCSJYIOVBSZ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | 3,5-dichloro-6-ethylpyrazine-2-carboxylic acid |
| InChIKey | KTDRCSJYIOVBSZ-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(C(=N1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)