Products 1884425-10-8
CAS 1884425-10-8 appears in our catalog under these names: 7-Fluoro-1,2,3,4-tetrahydro-naphthalen-2-ylamine hydrochloride, 7-Fluoro-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 100mg, 250mg.
7-fluoro-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (CAS 1884425-10-8) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 7-fluoro-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride. InChIKey: JPYORNCKNXWETH-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 7-fluoro-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
| InChIKey | JPYORNCKNXWETH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1N)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)