Products 188781-06-8
CAS 188781-06-8 is the registry number for Ethyl 2-hydroxy-4-phenylpyrimidine-5-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 2-oxo-6-phenyl-1H-pyrimidine-5-carboxylate (CAS 188781-06-8) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: ethyl 2-oxo-6-phenyl-1H-pyrimidine-5-carboxylate. InChIKey: RAGYYZDMZFSPMH-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | ethyl 2-oxo-6-phenyl-1H-pyrimidine-5-carboxylate |
| InChIKey | RAGYYZDMZFSPMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=O)N=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)