CAS 18879-72-6 is the registry number for 6-Ethoxy-2-methylbenzo(d)thiazole, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
6-ethoxy-2-methyl-1,3-benzothiazole (CAS 18879-72-6) is a chemical compound with the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. IUPAC name: 6-ethoxy-2-methyl-1,3-benzothiazole. InChIKey: PKRZJVQWLOOWHD-UHFFFAOYSA-N.
| Molecular formula | C10H11NOS |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | 6-ethoxy-2-methyl-1,3-benzothiazole |
| InChIKey | PKRZJVQWLOOWHD-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)N=C(S2)C |
Computed by PubChem (NCBI)