Products 1888643-71-7
CAS 1888643-71-7 is the registry number for 1-((tert-Butoxy)carbonyl)-3,5-dimethylpiperidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 1888643-71-7) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 3,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: GJDKODUIJVWIAQ-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 3,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | GJDKODUIJVWIAQ-UHFFFAOYSA-N |
| SMILES | CC1CC(C(N(C1)C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)