CAS 1889779-77-4 is the registry number for 5-AMINOISOPHTHALIC ACID HYDRATE, 97%. Offered by: AmBeed. Available pack sizes: 25g.
5-aminobenzene-1,3-dicarboxylic acid;hydrate (CAS 1889779-77-4) is a chemical compound with the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. IUPAC name: 5-aminobenzene-1,3-dicarboxylic acid;hydrate. InChIKey: JXTAIJSVIRWYQH-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 5-aminobenzene-1,3-dicarboxylic acid;hydrate |
| InChIKey | JXTAIJSVIRWYQH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)N)C(=O)O.O |
Computed by PubChem (NCBI)