Products 1889779-77-4

CAS 1889779-77-4 is the registry number for 5-AMINOISOPHTHALIC ACID HYDRATE, 97%. Offered by: AmBeed. Available pack sizes: 25g.

Structural formula: {0} (CAS {1})

5-aminobenzene-1,3-dicarboxylic acid;hydrate (CAS 1889779-77-4) is a chemical compound with the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. IUPAC name: 5-aminobenzene-1,3-dicarboxylic acid;hydrate. InChIKey: JXTAIJSVIRWYQH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO5
Molecular weight199.16 g/mol
IUPAC name5-aminobenzene-1,3-dicarboxylic acid;hydrate
InChIKeyJXTAIJSVIRWYQH-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1C(=O)O)N)C(=O)O.O

Computed by PubChem (NCBI)